CymitQuimica logo

CAS 269067-38-1

:

Fmoc-Cys(Mtt)-OH

Description:
Fmoc-Cys(Mtt)-OH, with the CAS number 269067-38-1, is a protected amino acid derivative commonly used in peptide synthesis. It features a phenylmethoxycarbonyl (Fmoc) group, which serves as a protective group for the amino functionality, allowing for selective reactions during peptide assembly. The cysteine (Cys) residue is modified with a 4-methyltrityl (Mtt) group, which protects the thiol side chain, preventing unwanted reactions during synthesis. This compound is typically utilized in solid-phase peptide synthesis (SPPS) due to its stability and compatibility with various coupling reagents. The Fmoc group can be removed under basic conditions, while the Mtt group can be cleaved under acidic conditions, allowing for the selective deprotection of the amino acid. The presence of the thiol group in cysteine also enables the formation of disulfide bonds, which are crucial for the structural integrity of many peptides and proteins. Overall, Fmoc-Cys(Mtt)-OH is a valuable building block in the field of peptide chemistry, facilitating the synthesis of complex peptides with specific functionalities.
Formula:C38H33NO4S
InChI:InChI=1S/C38H33NO4S/c1-26-20-22-29(23-21-26)38(27-12-4-2-5-13-27,28-14-6-3-7-15-28)44-25-35(36(40)41)39-37(42)43-24-34-32-18-10-8-16-30(32)31-17-9-11-19-33(31)34/h2-23,34-35H,24-25H2,1H3,(H,39,42)(H,40,41)/t35-/m0/s1
InChI key:PCCZXLMDPCBTSL-DHUJRADRSA-N
SMILES:CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46
Synonyms:
  • N-Alpha-(9-Fluorenylmethoxycarbonyl)-N-Beta-4-Methyltrityl-L-Cysteine
  • Fmoc-S-4-Methyltrityl-L-Cysteine
  • Fmoc-Cysteine(Mtt)-Oh
  • L-Cysteine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-S-[(4-methylphenyl)diphenylmethyl]-
Found 7 products.