CAS 26907-37-9
:N,N′-Bis(1,3,4-thiadiazol-2-yl)methanediamine
Description:
N,N′-Bis(1,3,4-thiadiazol-2-yl)methanediamine, with the CAS number 26907-37-9, is a chemical compound characterized by its unique structure, which includes two 1,3,4-thiadiazole rings connected to a methanediamine backbone. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the thiadiazole moiety, which is known for its antimicrobial and antifungal properties. The presence of amino groups in the methanediamine structure may enhance its reactivity and solubility in various solvents. Additionally, the compound may display interesting coordination chemistry, making it a candidate for applications in materials science or as a ligand in metal complexes. Its stability, solubility, and reactivity can vary depending on the specific conditions, such as pH and temperature. Overall, N,N′-Bis(1,3,4-thiadiazol-2-yl)methanediamine is a compound of interest in both synthetic and applied chemistry fields.
Formula:C5H6N6S2
InChI:InChI=1S/C5H6N6S2/c1(6-4-10-8-2-12-4)7-5-11-9-3-13-5/h2-3H,1H2,(H,6,10)(H,7,11)
InChI key:InChIKey=WMAHFAYLCMTHCB-UHFFFAOYSA-N
SMILES:N(CNC1=NN=CS1)C2=NN=CS2
Synonyms:- N,N′-Methylenebis(2-amino-1,3,4-thiadiazole)
- N,N′-Bis(1,3,4-thiadiazol-2-yl)methanediamine
- NSC 143019
- 1,3,4-Thiadiazole, 2,2′-(methylenediimino)bis-
- Methanediamine, N,N′-bis(1,3,4-thiadiazol-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N'-Di(1,3,4-thiadiazol-2-yl)methanediamine
CAS:Controlled ProductStability Light Sensitive
Applications N,N'-Di(1,3,4-thiadiazol-2-yl)methanediamine inhibits DNA and RNA syntheses by mouse embryo cells.
References Tsukamoto, K., et. al.: Cancer Res., 35, 2631 (1975)Formula:C5H6N6S2Color and Shape:NeatMolecular weight:214.2713
