CAS 26908-38-3

pyrimido[4,5-b]quinoline-2,4(1H,3H)-dione

Description:

Pyrimido[4,5-b]quinoline-2,4(1H,3H)-dione, identified by its CAS number 26908-38-3, is a heterocyclic compound featuring a fused pyrimidine and quinoline structure. This compound is characterized by its bicyclic framework, which contributes to its unique chemical properties. It typically exhibits a range of biological activities, making it of interest in medicinal chemistry and drug development. The presence of the dione functional groups suggests potential reactivity, particularly in nucleophilic addition reactions. Pyrimido[4,5-b]quinoline-2,4(1H,3H)-dione may also display fluorescence properties, which can be advantageous for applications in imaging or sensing. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its practical applications. Overall, this compound represents a significant class of heterocycles with potential utility in various fields, including pharmaceuticals and materials science.

Formula: C₁₁H₇N₃O₂

InChI: InChI=1/C11H7N3O2/c15-10-7-5-6-3-1-2-4-8(6)12-9(7)13-11(16)14-10/h1-5H,(H2,12,13,14,15,16)

Synonyms:

• Deazaflavin
• 5-deazaflavin

5-deazaflavin

CAS: 26908-38-3

Formula: C₁₁H₇N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 213.1922

Ref: IN-DA00CE1P

1h,2h,3h,4h-Pyrimido[4,5-b]quinoline-2,4-dione

CAS: 26908-38-3

1h,2h,3h,4h-Pyrimido[4,5-b]quinoline-2,4-dione

Purity: 95%

Ref: 54-OR1041875

5-Deazaflavin

CAS: 26908-38-3

Formula: C₁₁H₇N₃O₂

Molecular weight: 213.20

Ref: 4Z-R-6820

1h,2h,3h,4h-Pyrimido[4,5-b]quinoline-2,4-dione

CAS: 26908-38-3

Purity: 95%

Molecular weight: 213.1959991

Ref: 10-F653427

1H,2H,3H,4H-Pyrimido[4,5-b]quinoline-2,4-dione

CAS: 26908-38-3

1H,2H,3H,4H-Pyrimido[4,5-b]quinoline-2,4-dione is a small molecule drug that inhibits the activity of complex enzymes. It binds to the enzyme and prevents it from performing its normal function. The compound has been shown to inhibit cancer cells in mammalian cell cultures and in animal studies. 1H,2H,3H,4H-Pyrimido[4,5-b]quinoline-2,4-dione is water soluble and can be hydrolysed by nitro groups. It has been shown to bind to aromatic hydrocarbons such as benzene and phenol.
1H,2H,3H,4H-Pyrimido[4,5-b]quinoline-2,4-dione has not yet been tested for toxicity or carcinogenicity in humans.

Formula: C₁₁H₇N₃O₂

Purity: Min. 95%

Molecular weight: 213.19 g/mol

Ref: 3D-BBA90838

5-Deazaflavin

CAS: 26908-38-3

Formula: C₁₁H₇N₃O₂

Molecular weight: 213.2

Ref: ST-EA-CP-R41015