CAS 26908-82-7

(4-Methylphenyl)sulfonyl acetate

Description:

(4-Methylphenyl)sulfonyl acetate, with the CAS number 26908-82-7, is an organic compound characterized by the presence of a sulfonyl group attached to an acetate moiety and a para-methylphenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its role as a reagent in organic synthesis, particularly in the formation of sulfonyl esters and as an electrophile in various chemical reactions. The sulfonyl group contributes to its reactivity, making it useful in nucleophilic substitution reactions. Additionally, the presence of the methyl group on the aromatic ring can influence the electronic properties of the molecule, enhancing its reactivity and solubility in organic solvents. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, (4-Methylphenyl)sulfonyl acetate is a valuable compound in synthetic organic chemistry, with applications in pharmaceuticals and materials science.

Formula: C₉H₁₀O₄S

InChI: InChI=1/C9H10O4S/c1-7-3-5-9(6-4-7)14(11,12)13-8(2)10/h3-6H,1-2H3

SMILES: Cc1ccc(cc1)S(=O)(=O)OC(=O)C

Synonyms:

• P-Tolylsulfonyl Acetate