CAS 26911-39-7
:5-Hydroxy-4-oxo-L-norvaline
Description:
5-Hydroxy-4-oxo-L-norvaline, with the CAS number 26911-39-7, is an amino acid derivative that features a hydroxyl group and a keto group in its structure, which contributes to its unique chemical properties. This compound is characterized by its ability to participate in various biochemical reactions due to the presence of both functional groups. It is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation but may play roles in metabolic pathways or serve as a precursor for other bioactive molecules. The presence of the hydroxyl group enhances its solubility in polar solvents, while the keto group can engage in tautomerization, influencing its reactivity. Additionally, 5-Hydroxy-4-oxo-L-norvaline may exhibit biological activity, potentially impacting processes such as enzyme inhibition or modulation of metabolic pathways. Its specific applications and effects in biological systems are subjects of ongoing research, highlighting its significance in the field of biochemistry and pharmacology.
Formula:C5H9NO4
InChI:InChI=1S/C5H9NO4/c6-4(5(9)10)1-3(8)2-7/h4,7H,1-2,6H2,(H,9,10)/t4-/m0/s1
InChI key:InChIKey=FRTKOPTWTJLHNO-BYPYZUCNSA-N
SMILES:C([C@@H](C(O)=O)N)C(CO)=O
Synonyms:- 5-Hydroxy-4-oxo-L-norvaline
- Levulinic acid, 2-amino-5-hydroxy-, L-
- L-Norvaline, 5-hydroxy-4-oxo-
- δ-Hydroxy-γ-oxo-L-norvaline
- RI 331
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Hydroxy-4-oxo-L-norvaline
CAS:<p>5-Hydroxy-4-oxo-L-norvaline is an antifungal antibiotic that inhibits protein biosynthesis.</p>Formula:C5H9NO4Color and Shape:SolidMolecular weight:147.129
