
CAS 26921-72-2
:3-(2H-Tetrazol-5-yloxy)phenol
Description:
3-(2H-Tetrazol-5-yloxy)phenol, with the CAS number 26921-72-2, is an organic compound characterized by the presence of a phenolic group and a tetrazole moiety. This compound features a tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom, contributing to its unique chemical properties. The phenolic component provides hydroxyl (-OH) functionality, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. The presence of the tetrazole group often imparts biological activity, making such compounds of interest in medicinal chemistry and pharmacology. Additionally, the compound may exhibit properties such as stability under various conditions, potential for forming salts, and reactivity with electrophiles or nucleophiles due to the functional groups present. Overall, 3-(2H-Tetrazol-5-yloxy)phenol is a versatile compound with applications in research and development, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C7H6N4O2
InChI:InChI=1S/C7H6N4O2/c12-5-2-1-3-6(4-5)13-7-8-10-11-9-7/h1-4,12H,(H,8,9,10,11)
InChI key:InChIKey=DZHBTQHPZSGDOR-UHFFFAOYSA-N
SMILES:O(C1=CC(O)=CC=C1)C=2NN=NN2
Synonyms:- 3-(2H-Tetrazol-5-yloxy)phenol
- Phenol, 3-(1H-tetrazol-5-yloxy)-
- 5-(3-Hydroxyphenoxy)-1H-tetrazole
- Phenol, 3-(2H-tetrazol-5-yloxy)-
- Phenol, m-(1H-tetrazol-5-yloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Melizame
CAS:<p>Melizame is a bioactive chemical.</p>Formula:C7H6N4O2Color and Shape:SolidMolecular weight:178.15
