CAS 26932-45-6

(2S,2'S)-3,3'-diselane-1,2-diylbis(2-aminopropanoic acid) (non-preferred name)

Description:

The chemical substance known as (2S,2'S)-3,3'-diselane-1,2-diylbis(2-aminopropanoic acid), with the CAS number 26932-45-6, is a complex organic compound featuring a diselane backbone. This compound contains two amino acid moieties, specifically 2-aminopropanoic acid, which is commonly known as alanine. The presence of the diselane structure indicates that it contains silicon-silicon bonds, which can impart unique properties such as increased stability and potential reactivity compared to traditional carbon-based compounds. The stereochemistry denoted by (2S,2'S) suggests that the molecule has specific spatial arrangements that can influence its biological activity and interactions. This compound may exhibit interesting characteristics in terms of solubility, reactivity, and potential applications in fields such as materials science or biochemistry. However, detailed studies would be necessary to fully understand its properties, behavior in various environments, and potential uses in research or industry.

Formula: C₆H₁₂N₂O₄Se₂

InChI: InChI=1/C6H12N2O4Se2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1

SMILES: C([C@H](C(=O)O)N)[Se][Se]C[C@H](C(=O)O)N

D-Selenocystine

CAS: 26932-45-6

Formula: C₆H₁₂N₂O₄Se₂

Molecular weight: 334.11

Ref: 7W-GW8825

D-Selenocystine

Controlled Product

CAS: 26932-45-6

Applications D-Selenocystine is a useful reagent in the preparation of firefly L-Luciferin with bioluminescence emission.
References Conley, N. et al.: Angew. Chem. Int. Ed., 51, 3350 (2012);

Formula: C₆H₁₂N₂O₄Se₂

Color and Shape: Neat

Molecular weight: 334.091

Ref: TR-S253108

D-Selenocystine

CAS: 26932-45-6

Selenocystine is a non-protein amino acid that belongs to the group of selenoamino acids. Selenocystine is found in plants and microorganisms, where it plays a role in bacterial metabolism. Selenocystine can be synthesized by bacteria from D-glutamate, cysteine, and hydrogen sulfide. It has been shown to have synergistic effects with other compounds such as carbon sources, hydroxyl ions, and subunits. Selenocystine has been shown to inhibit the growth of certain strains of bacteria that are resistant to antibiotics such as penicillin or erythromycin. These effects are mediated through the mitochondrial membrane potential and may also be due to its ability to inhibit microbial respiration.

Formula: C₆H₁₂N₂O₄Se₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 334.09 g/mol

Ref: 3D-FS72620