CAS 26936-24-3
:Methacrylic acid-methyl acrylate-methyl methacrylate copolymer
Description:
Methacrylic acid-methyl acrylate-methyl methacrylate copolymer, identified by the CAS number 26936-24-3, is a versatile polymer commonly used in various applications due to its unique properties. This copolymer is formed from the polymerization of methacrylic acid, methyl acrylate, and methyl methacrylate, resulting in a material that exhibits a combination of hydrophilic and hydrophobic characteristics. It typically possesses good adhesion properties, making it suitable for coatings, adhesives, and sealants. The presence of methacrylic acid imparts functionality, allowing for potential interactions with other materials, while the acrylate components enhance flexibility and durability. This copolymer is often utilized in the formulation of paints, inks, and cosmetic products due to its ability to form films and provide a smooth finish. Additionally, it can be modified to achieve specific properties, such as increased gloss or improved weather resistance, making it a valuable component in various industrial and consumer applications.
Formula:C13H20O6
InChI:InChI=1/C5H8O2.2C4H6O2/c1-4(2)5(6)7-3;1-3-4(5)6-2;1-3(2)4(5)6/h1H2,2-3H3;3H,1H2,2H3;1H2,2H3,(H,5,6)
InChI key:InChIKey=NZEXUPLJXSDMCK-UHFFFAOYSA-N
SMILES:C(C=C)(OC)=O.C(C(C)=C)(OC)=O.C(C(O)=O)(C)=C
Synonyms:- 2-Propenoic acid, 2-methyl-, polymer with methyl 2-methyl-2-propenoate and methyl 2-propenoate
- Methacrylic acid, polymer with methyl acrylate and methyl methacrylate
- Methacrylic acid methyl ester, polymer with methacrylic acid and methyl acrylate
- 2-Propenoic acid, 2-methyl-, methyl ester, polymer with methyl 2-propenoate and 2-methyl-2-propenoic acid
- Acrylic acid methyl ester, polymer with methacrylic acid and methyl methacrylate
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl Acrylate, Methyl Methacrylate and Methacrylic Acid (7:3:1) Copolymer 280000 Dispersion
CAS:Other acrylic polymers in primary forms (excluding elastomeric)Color and Shape:White LiquidMolecular weight:203.09061

