CAS 269396-58-9
:(R)-3-amino-4-(3,4-difluoro-phenyl)-butyric acid-HCl
Description:
(R)-3-amino-4-(3,4-difluoro-phenyl)-butyric acid-HCl is a chemical compound characterized by its chiral center, which contributes to its specific stereochemistry. As an amino acid derivative, it contains both an amino group and a carboxylic acid group, making it a zwitterionic molecule in physiological conditions. The presence of the 3,4-difluorophenyl group enhances its lipophilicity and may influence its biological activity, potentially making it a candidate for pharmaceutical applications. The hydrochloride salt form indicates that the compound is protonated, which can improve its solubility in aqueous solutions, a desirable property for drug formulation. This compound may exhibit specific interactions with biological targets, and its structural features suggest potential roles in medicinal chemistry, particularly in the development of therapeutics for neurological or metabolic disorders. As with many compounds, the precise characteristics, including solubility, stability, and reactivity, can be influenced by environmental factors and the presence of other substances.
Formula:C10H12ClF2NO2
InChI:InChI=1/C10H11F2NO2.ClH/c11-8-2-1-6(4-9(8)12)3-7(13)5-10(14)15;/h1-2,4,7H,3,5,13H2,(H,14,15);1H/t7-;/m1./s1
SMILES:c1cc(c(cc1C[C@H](CC(=O)O)N)F)F.Cl
Synonyms:- D-3-Amino-4-(3,4-difluorophenyl)-butyric acid
- Benzenebutanoic acid, β-amino-3,4-difluoro-, (betaR)-, hydrochloride (1:1)
- H-D-β-HoPhe(3,4-DiF)-OH.HCl
- (R)-3-Amino-4-(3,4-Difluorophenyl)Butanoic Acid Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Sitagliptin Impurity 57 HCl
CAS:Formula:C10H11F2NO2·HClColor and Shape:Pale Yellow SolidMolecular weight:215.20 36.46
