CymitQuimica logo

CAS 269396-66-9

:

Fmoc-(R)-3-amino-4-(3-pyridyl)-butyric acid

Description:
Fmoc-(R)-3-amino-4-(3-pyridyl)-butyric acid is a chemical compound characterized by its structure, which includes a 3-amino group and a 3-pyridyl moiety attached to a butyric acid backbone. The Fmoc (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino functionality, commonly used in peptide synthesis to prevent unwanted reactions during the coupling process. This compound is typically utilized in the field of medicinal chemistry and peptide synthesis, particularly for the development of bioactive peptides. Its chirality, indicated by the (R) configuration, is significant for biological activity, as the spatial arrangement of atoms can influence the compound's interaction with biological targets. The presence of the pyridine ring contributes to its potential as a ligand or pharmacophore in drug design. Overall, Fmoc-(R)-3-amino-4-(3-pyridyl)-butyric acid is a versatile building block in organic synthesis and pharmaceutical applications.
Formula:C24H22N2O4
InChI:InChI=1/C24H22N2O4/c27-23(28)13-17(12-16-6-5-11-25-14-16)26-24(29)30-15-22-20-9-3-1-7-18(20)19-8-2-4-10-21(19)22/h1-11,14,17,22H,12-13,15H2,(H,26,29)(H,27,28)/t17-/m1/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@H](Cc1cccnc1)CC(=O)O)O
Synonyms:
  • (3R)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-pyridin-3-ylbutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.