CymitQuimica logo

CAS 269398-89-2

:

Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid

Description:
Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is a chemical compound commonly used in peptide synthesis and drug development. It features a fluorenylmethyloxycarbonyl (Fmoc) protecting group, which is widely utilized in solid-phase peptide synthesis due to its stability under basic conditions and ease of removal under acidic conditions. The compound contains an amino acid structure with a chiral center, specifically the (R)-enantiomer, which is significant for biological activity and specificity. The presence of the naphthyl group contributes to its hydrophobic characteristics, influencing solubility and interaction with biological membranes. This compound is typically used in the synthesis of peptides that require specific stereochemistry and functional properties, making it valuable in medicinal chemistry and biochemistry research. Its CAS number, 269398-89-2, allows for precise identification and retrieval of information regarding its properties, safety data, and applications in scientific literature. Overall, Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is an important tool in the field of synthetic organic chemistry.
Formula:C29H25NO4
InChI:InChI=1/C29H25NO4/c30-26(16-27(31)32)28(24-15-7-9-18-8-1-2-10-19(18)24)29(33)34-17-25-22-13-5-3-11-20(22)21-12-4-6-14-23(21)25/h1-15,25-26,28H,16-17,30H2,(H,31,32)/t26-,28?/m1/s1
InChI key:QKDVUQGMQTZWKV-OAQYLSRUSA-N
SMILES:c1ccc2c(c1)cccc2C([C@@H](CC(=O)O)N)C(=O)OCC1c2ccccc2c2ccccc12
Synonyms:
  • (3S)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-naphthalen-1-ylbutanoic acid
  • Fmoc-D-β-HoAla(1-Naphthyl)-OH
Found 4 products.