CAS 269402-44-0

6-Chloro-1,2,3,4-tetrahydro-1-methylisoquinoline

Description:

6-Chloro-1,2,3,4-tetrahydro-1-methylisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a bicyclic system featuring a fused benzene and pyridine ring. The presence of a chlorine atom at the 6-position and a methyl group at the 1-position contributes to its unique reactivity and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it suitable for various synthetic applications in organic chemistry. The tetrahydro configuration indicates that it has undergone partial hydrogenation, resulting in a saturated structure that may influence its pharmacological properties. Compounds of this class are often studied for their potential therapeutic effects, including neuroactive properties, due to their ability to interact with various biological targets. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks or environmental hazards.

Formula: C₁₀H₁₂ClN

InChI: InChI=1S/C10H12ClN/c1-7-10-3-2-9(11)6-8(10)4-5-12-7/h2-3,6-7,12H,4-5H2,1H3

InChI key: InChIKey=MPXZXQCXHQSKAT-UHFFFAOYSA-N

SMILES: CC1C=2C(=CC(Cl)=CC2)CCN1

Synonyms:

• Isoquinoline, 6-chloro-1,2,3,4-tetrahydro-1-methyl-
• 6-Chloro-1,2,3,4-tetrahydro-1-methylisoquinoline

6-Chloro-1-methyl-1,2,3,4-tetrahydroisoquinoline

CAS: 269402-44-0

Versatile small molecule scaffold

Formula: C₁₀H₁₂ClN

Purity: Min. 95%

Molecular weight: 181.66 g/mol

Ref: 3D-UKA40244