CAS 269409-73-6
:3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
Description:
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, with the CAS number 269409-73-6, is a chemical compound that features a benzoic acid moiety substituted with a dioxaborolane group. This compound is characterized by its boron-containing structure, which is significant for its potential applications in organic synthesis and materials science. The presence of the dioxaborolane group enhances its reactivity, particularly in cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. The tetramethyl substituents contribute to the compound's steric bulk, influencing its solubility and reactivity. Additionally, the carboxylic acid functional group provides acidic properties, allowing for potential interactions in various chemical environments. Overall, this compound exemplifies the integration of boron chemistry with organic functional groups, showcasing its utility in synthetic methodologies and possibly in the development of advanced materials.
Formula:C13H17BO4
InChI:InChI=1/C13H17BO4/c1-12(2)13(3,4)18-14(17-12)10-7-5-6-9(8-10)11(15)16/h5-8H,1-4H3,(H,15,16)
SMILES:CC1(C)C(C)(C)OB(c2cccc(c2)C(=O)O)O1
Synonyms:- 3-Carboxyphenylboronic acid pinacol ester
- (3-Carboxyphenyl)Boronic Acid, Pinacol Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic Acid
CAS:Formula:C13H17BO4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:248.093-Carboxybenzeneboronic acid pinacol ester, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H17BO4Purity:97%Molecular weight:248.093-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, min. 97%
CAS:3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, min. 97%
Formula:C13H17BO4Purity:min. 97%Color and Shape:white pwdr.Molecular weight:248.093-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
CAS:Formula:C13H17BO4Purity:98%Color and Shape:SolidMolecular weight:248.08273-Carboxybenzeneboronic acid, pinacol ester
CAS:3-Carboxybenzeneboronic acid, pinacol esterPurity:97%Color and Shape:Beige SolidMolecular weight:248.08g/mol3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
CAS:Formula:C13H17BO4Purity:98%Color and Shape:SolidMolecular weight:248.09





