CAS 269409-97-4
:2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
Description:
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, with the CAS number 269409-97-4, is a chemical compound that features a phenolic structure substituted with a boron-containing moiety. This compound is characterized by its dioxaborolane ring, which contributes to its unique reactivity and potential applications in organic synthesis, particularly in the field of boron chemistry. The presence of the tetramethyl groups enhances its solubility and stability, making it suitable for various chemical reactions. As a phenol derivative, it exhibits properties typical of phenolic compounds, such as the ability to act as an acid and participate in hydrogen bonding. Its boron atom can engage in coordination chemistry, making it useful in catalysis and as a building block in the synthesis of more complex molecules. Overall, this compound is of interest in materials science and medicinal chemistry due to its distinctive structural features and functional properties.
Formula:C12H17BO3
InChI:InChI=1/C12H17BO3/c1-11(2)12(3,4)16-13(15-11)9-7-5-6-8-10(9)14/h5-8,14H,1-4H3
SMILES:CC1(C)C(C)(C)OB(c2ccccc2O)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
CAS:Formula:C12H17BO3Purity:98%Color and Shape:LiquidMolecular weight:220.07262-Hydroxybenzeneboronic acid, pinacol ester
CAS:2-Hydroxybenzeneboronic acid, pinacol esterFormula:C12H17BO3Purity:98%Color and Shape: colourless to light yellow low melting solidMolecular weight:220.07g/mol2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
CAS:Formula:C12H17BO3Purity:>97.0%(GC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:220.082-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2yl)phenol
CAS:Formula:C12H17BO3Purity:98%Color and Shape:Liquid, OilMolecular weight:220.082-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
CAS:<p>2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol is a fluorophore that can be used for analytical chemistry. It is a fluorescent and transition metal probe with a high yield of around 70%. The compound has been found to react with nucleophile and kinetic reactions in the presence of natural products. 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenol has also been shown to fluoresce brightly when exposed to ultraviolet light. This product can be used as a probe in molecular orbitals or kinetic experiments.</p>Formula:C12H17BO3Purity:Min. 95%Molecular weight:220.08 g/mol




