CAS 26947-41-1

3-isoquinolinecarbonitrile

Description:

3-Isoquinolinecarbonitrile is an organic compound characterized by its isoquinoline structure, which features a bicyclic aromatic system. It contains a cyano group (-C≡N) attached to the carbon atom at the 3-position of the isoquinoline ring. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential applications in medicinal chemistry and as a building block in organic synthesis. The presence of the cyano group contributes to its reactivity, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, 3-isoquinolinecarbonitrile may exhibit biological activity, which has been the subject of research in drug development. Its molecular structure allows for various functionalizations, enhancing its versatility in chemical reactions. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₁₀H₆N₂

InChI: InChI=1/C10H6N2/c11-6-10-5-8-3-1-2-4-9(8)7-12-10/h1-5,7H

SMILES: c1ccc2cnc(cc2c1)C#N

Synonyms:

• Isoquinoline-3-carbonitrile

Isoquinoline-3-carbonitrile

CAS: 26947-41-1

Formula: C₁₀H₆N₂

Purity: 96%

Color and Shape: Solid, Of-white powder

Molecular weight: 154.172

Ref: 10-F068841

3-ISOQUINOLINECARBONITRILE

CAS: 26947-41-1

Formula: C₁₀H₆N₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 154.1680

Ref: IN-DA0037GL

3-Isoquinolinecarbonitrile

CAS: 26947-41-1

3-Isoquinolinecarbonitrile

Purity: 98%

Molecular weight: 154.17g/mol

Ref: 54-OR930950