CAS 26964-24-9
:6-Methoxyflavone
Description:
6-Methoxyflavone is a flavonoid compound characterized by its methoxy group at the 6-position of the flavone structure. It typically appears as a yellow crystalline solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. This compound is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties, making it of interest in pharmacological research. Its molecular structure consists of a flavone backbone, which is a polyphenolic structure, contributing to its reactivity and interaction with various biological targets. 6-Methoxyflavone has been studied for its effects on various cellular pathways and may influence enzyme activity, particularly in relation to metabolic processes. Additionally, it is often used in studies exploring the role of flavonoids in health and disease, highlighting its significance in natural product chemistry and medicinal applications. As with many flavonoids, its safety profile and efficacy in therapeutic contexts are subjects of ongoing research.
Formula:C16H12O3
InChI:InChI=1S/C16H12O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-10H,1H3
InChI key:InChIKey=XZQLSABETMKIGG-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC=CC=C3)=CC=C(OC)C2
Synonyms:- 4H-1-Benzopyran-4-one, 6-methoxy-2-phenyl-
- 6-Methoxy-2-phenyl-4-benzopyrone
- 6-Methoxy-2-phenyl-4H-1-benzopyran-4-one
- 6-Methoxy-2-phenylchromone
- 6-methoxy-2-phenyl-4H-chromen-4-one
- Brn 0218520
- Flavone, 6-methoxy-
- Flavone, 6-methoxy- (7CI,8CI)
- 6-Methoxyflavone
- 5-18-02-00257 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
6-Methoxyflavone
CAS:6-Methoxyflavone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C16H12O3Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:252.286-Methoxy-2-phenyl-4H-chromen-4-one
CAS:Formula:C16H12O3Purity:98%Color and Shape:SolidMolecular weight:252.2647Ref: IN-DA003N9T
1g55.00€5g135.00€10g180.00€25g318.00€100gTo inquire100mg28.00€250mg28.00€500mg46.00€6-Methoxy-2-Phenyl-4H-Chromen-4-One
CAS:6-Methoxy-2-Phenyl-4H-Chromen-4-OnePurity:99%Molecular weight:252.26g/mol6-Methoxyflavone
CAS:Formula:C16H12O3Purity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:252.276-Methoxyflavone
CAS:6-Methoxyflavone is one of the methoxyflavone isolated form Pimelea decora. Synthesis of 6-methoxyflavone from p-dihydroxybenzene has been reported.Formula:C16H12O3Purity:99.94%Color and Shape:SolidMolecular weight:252.266-Methoxyflavone
CAS:6-Methoxyflavone is a flavonoid compound, which is a naturally occurring product found in certain plants. It is characterized by the presence of a methoxy group attached to the flavone backbone. This compound is typically extracted from plant sources such as citrus fruits and certain herbs that have a high content of polyphenolic compounds. Its mode of action involves modulating various biochemical pathways, including the inhibition of specific enzymes and interaction with cellular receptors, potentially affecting oxidative stress and inflammation pathways.Formula:C16H12O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:252.26 g/mol







