CAS 26964-29-4
:3,5,7-Trimethoxyflavone
Description:
3,5,7-Trimethoxyflavone, with the CAS number 26964-29-4, is a flavonoid compound characterized by the presence of three methoxy groups attached to the flavone backbone at the 3, 5, and 7 positions. This structural arrangement contributes to its unique chemical properties and biological activities. The compound typically exhibits a yellow to orange color, which is common among flavonoids, and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). 3,5,7-Trimethoxyflavone is known for its potential antioxidant, anti-inflammatory, and anticancer properties, making it of interest in pharmacological research. Its mechanism of action may involve the modulation of various signaling pathways and the scavenging of free radicals. Additionally, this compound may interact with various biological targets, contributing to its therapeutic potential. As with many flavonoids, its bioavailability and efficacy can be influenced by factors such as formulation and metabolic processes within the body. Overall, 3,5,7-Trimethoxyflavone represents a significant area of study within natural product chemistry and medicinal research.
Formula:C18H16O5
InChI:InChI=1S/C18H16O5/c1-20-12-9-13(21-2)15-14(10-12)23-17(18(22-3)16(15)19)11-7-5-4-6-8-11/h4-10H,1-3H3
InChI key:InChIKey=CBTHKWVPSIGKMI-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=C(OC)C2=O)C3=CC=CC=C3)=CC(OC)=C1
Synonyms:- 3,5,7-Tri-O-methylgalangin
- 3,5,7-Trimethoxy-2-phenyl-4H-1-benzopyran-4-one
- 3,5,7-Trimethoxyflavone
- 4H-1-benzopyran-4-one, 3,5,7-trimethoxy-2-phenyl-
- Flavone, 3,5,7-trimethoxy-
- Mrs 928
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
MRS928
CAS:MRS928 (3,5,7-Trimethoxyflavone) is a bioactive chemical. It has a role as a plant metabolite. It derives from a galangin.Formula:C18H16O5Purity:98.01% - 98.71%Color and Shape:SolidMolecular weight:312.323,5,7-Trimethoxyflavone
CAS:<p>3,5,7-Trimethoxyflavone is a natural product that belongs to the group of fatty acids. It has been shown to have anti-inflammatory effects, inhibiting production of tumour necrosis factor-α (TNF-α) and other inflammatory cytokines in human macrophages. 3,5,7-Trimethoxyflavone also inhibits the production of prostaglandins and leukotrienes. The root powder has potent inhibitory effects on TNF-α production by lipopolysaccharide stimulated monocytes. This compound was found to be cytotoxic against basophilic leukemia cells as well as adjuvant therapy for tumours that are resistant to glucocorticoid therapy or do not respond to conventional chemotherapy. 3,5,7-Trimethoxyflavone has two methoxy groups that can be used for chromatographic separation by gas chromatography.</p>Formula:C18H16O5Purity:90%MinColor and Shape:SolidMolecular weight:312.32 g/mol



