CAS 269726-81-0: (βR)-2-Cyano-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid

Description:(βR)-2-Cyano-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid, with CAS number 269726-81-0, is a synthetic organic compound characterized by its complex structure, which includes a cyano group, an amino group protected by a fluorenylmethoxycarbonyl (Fmoc) moiety, and a benzenebutanoic acid backbone. This compound is typically used in peptide synthesis and as an intermediate in the development of pharmaceuticals due to its ability to facilitate the formation of peptide bonds. The presence of the cyano group enhances its reactivity, making it a valuable building block in organic synthesis. The Fmoc protection allows for selective deprotection under mild conditions, which is advantageous in multi-step synthesis processes. Additionally, the compound's chirality, indicated by the (βR) designation, suggests that it may exhibit specific biological activities or interactions, making it of interest in medicinal chemistry and drug development. Overall, this compound exemplifies the intricate design often required in the synthesis of biologically active molecules.

Formula:C₂₆H₂₂N₂O₄

InChI:InChI=1S/C26H22N2O4/c27-15-18-8-2-1-7-17(18)13-19(14-25(29)30)28-26(31)32-16-24-22-11-5-3-9-20(22)21-10-4-6-12-23(21)24/h1-12,19,24H,13-14,16H2,(H,28,31)(H,29,30)/t19-/m1/s1

InChI key:InChIKey=IIXHWVWQIRQSSX-LJQANCHMSA-N

SMILES:N#CC=1C=CC=CC1CC(NC(=O)OCC2C=3C=CC=CC3C=4C=CC=CC42)CC(=O)O

Synonyms:
Fmoc-D-β-HoPhe(2-CN)-OH
(3R)-4-(2-cyanophenyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid
Benzenebutanoic acid, 2-cyano-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (βR)-
(βR)-2-Cyano-β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
FMOC-(R)-3-AMINO-4-(2-CYANO-PHENYL)-BUTYRIC ACID REF: IN-DA00BCWXCAS: 269726-81-0	- - -	To inquire	Mon 07 Apr 25
(R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(2-cyanophenyl)butanoic acid REF: 10-F764786CAS: 269726-81-0	98%	- - -	Discontinued product
Fmoc-(R)-3-amino-4-(2-cyanophenyl)-butyric acid REF: 3D-UKA72681CAS: 269726-81-0	Min. 95%	- - -	Discontinued product