CAS 2698-43-3
:(2-Fluorobenzylidene)malononitrile
Description:
(2-Fluorobenzylidene)malononitrile, with the CAS number 2698-43-3, is an organic compound characterized by its unique structure, which includes a malononitrile moiety and a fluorobenzylidene group. This compound typically appears as a solid and is known for its potential applications in organic synthesis and materials science, particularly in the development of dyes and sensors. The presence of the fluorine atom in the benzylidene group can influence the compound's electronic properties, enhancing its reactivity and stability. Additionally, malononitrile contributes to the compound's ability to participate in various chemical reactions, such as nucleophilic additions and cycloadditions. The compound's properties, including solubility and melting point, can vary based on the specific conditions and purity. Overall, (2-Fluorobenzylidene)malononitrile is of interest in research due to its functional groups that allow for diverse chemical transformations and potential applications in advanced materials.
Formula:C10H5FN2
InChI:InChI=1S/C10H5FN2/c11-10-4-2-1-3-9(10)5-8(6-12)7-13/h1-5H
InChI key:InChIKey=XLEWRBXVBOUONK-UHFFFAOYSA-N
SMILES:C(=C(C#N)C#N)C1=C(F)C=CC=C1
Synonyms:- (2-Fluorobenzylidene)malononitrile
- 2-(2-Fluorobenzylidene)-1,3-propane dinitrile
- 2-(2-Fluorobenzylidene)malononitrile
- 2-(2-Fluorophenyl)-1,1-dicyanoethylene
- 2-Fluorobenzalmalononitrile
- 2-[(2-Fluorophenyl)methylene]malononitrile
- 2-[(2-Fluorophenyl)methylene]propanedinitrile
- 2-[(2-Fluorophenyl)methylidene]propanedinitrile
- Malononitrile, (o-fluorobenzylidene)-
- NSC 637334
- Propanedinitrile, 2-[(2-Fluorophenyl)Methylene]-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[(2-Fluorophenyl)methylidene]propanedinitrile
CAS:2-[(2-Fluorophenyl)methylidene]propanedinitrilePurity:techMolecular weight:172.16g/mol
