CAS 26993-32-8
:(2E)-2-Hexadecen-1-ol
Description:
(2E)-2-Hexadecen-1-ol, with the CAS number 26993-32-8, is a long-chain unsaturated alcohol characterized by its aliphatic structure. It features a hexadecene backbone, indicating it has a total of 16 carbon atoms and a double bond located at the second carbon position, which is in the trans configuration (denoted by the "E" in its name). This compound is typically a colorless to pale yellow liquid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the hydroxyl (-OH) group imparts some polar characteristics, allowing it to participate in hydrogen bonding. (2E)-2-Hexadecen-1-ol is often used in various applications, including as a surfactant, emulsifier, or in the synthesis of other chemical compounds. Its unsaturation and long carbon chain contribute to its unique physical and chemical properties, making it of interest in both industrial and research contexts.
Formula:C16H32O
InChI:InChI=1S/C16H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h14-15,17H,2-13,16H2,1H3/b15-14+
InChI key:InChIKey=MIDSQDHRRBSMIZ-CCEZHUSRSA-N
SMILES:C(CCCCCCCC)CCCC/C=C/CO
Synonyms:- (E)-2-Hexadecen-1-ol
- 2-Hexadecen-1-ol, (2E)-
- (2E)-2-Hexadecen-1-ol
- 2-Hexadecen-1-ol, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(E)-2-Hexadecen-1-ol
CAS:Controlled Product<p>Applications (E)-2-Hexadecen-1-ol (cas# 26993-32-8) is a compound useful in organic synthesis.<br></p>Formula:C16H32OColor and Shape:NeatMolecular weight:240.42
