CAS 27022-50-0
:3-(trifluoromethyl)[1,2,4]triazolo[3,4-a]isoquinoline
Description:
3-(Trifluoromethyl)[1,2,4]triazolo[3,4-a]isoquinoline is a heterocyclic compound characterized by the presence of a trifluoromethyl group and a fused triazole-isoquinoline structure. This compound features a triazole ring, which contributes to its potential biological activity, and an isoquinoline moiety, known for its presence in various natural products and pharmaceuticals. The trifluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, making it of interest in medicinal chemistry. The compound's unique structure may impart specific electronic and steric properties, influencing its reactivity and interactions with biological targets. It may exhibit various pharmacological activities, including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. Additionally, the presence of fluorine atoms often affects the compound's solubility and volatility, which are important factors in drug design and development. Overall, 3-(trifluoromethyl)[1,2,4]triazolo[3,4-a]isoquinoline represents a class of compounds that could be valuable in the exploration of new therapeutic agents.
Formula:C11H6F3N3
InChI:InChI=1/C11H6F3N3/c12-11(13,14)10-16-15-9-8-4-2-1-3-7(8)5-6-17(9)10/h1-6H
SMILES:c1ccc2c(c1)ccn1c2nnc1C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.