CAS 270260-33-8

4-(pyridin-2-yloxy)benzonitrile

Description:

4-(Pyridin-2-yloxy)benzonitrile, identified by its CAS number 270260-33-8, is an organic compound characterized by its structure, which features a benzonitrile moiety substituted with a pyridin-2-yloxy group. This compound typically exhibits a white to off-white crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of various pharmaceuticals. The presence of both the pyridine and nitrile functional groups contributes to its chemical reactivity and solubility properties, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit specific biological activities, which can be explored in drug development contexts. Its molecular structure allows for interactions with biological targets, potentially influencing its pharmacological profile. As with many organic compounds, proper handling and storage are essential to maintain its stability and efficacy.

Formula: C₁₂H₈N₂O

InChI: InChI=1/C12H8N2O/c13-9-10-4-6-11(7-5-10)15-12-3-1-2-8-14-12/h1-8H

SMILES: c1ccnc(c1)Oc1ccc(cc1)C#N

4-(Pyridin-2-yloxy)benzonitrile

CAS: 270260-33-8

Formula: C₁₂H₈N₂O

Color and Shape: Solid

Molecular weight: 196.2047

Ref: IN-DA00C1U5

4-(Pyridin-2-yloxy)benzonitrile

CAS: 270260-33-8

4-(Pyridin-2-yloxy)benzonitrile

Formula: C₁₂H₈N₂O

Purity: 95%

Color and Shape: white powder

Molecular weight: 196.20g/mol

Ref: 54-OR9616

4-(Pyridin-2-yloxy)benzonitrile

CAS: 270260-33-8

4-(Pyridin-2-yloxy)benzonitrile is a reagent that is used in the synthesis of heterocycles. It is also a useful intermediate for the preparation of highly substituted pyridine derivatives. 4-(Pyridin-2-yloxy)benzonitrile can be used to synthesize complex compounds, such as pharmaceuticals and agricultural chemicals.

Formula: C₁₂H₈N₂O

Purity: Min. 95%

Molecular weight: 196.2 g/mol

Ref: 3D-FP53345