CAS 270262-99-2: (βS)-β-Amino-3-thiophenebutanoic acid
Description:(βS)-β-Amino-3-thiophenebutanoic acid, identified by its CAS number 270262-99-2, is an amino acid derivative characterized by the presence of a thiophene ring, which contributes to its unique chemical properties. This compound features a β-amino group, indicating that the amino group is located on the second carbon of the carbon chain, which is typical for certain biologically active compounds. The thiophene moiety enhances its potential for interactions in biological systems, possibly influencing its solubility and reactivity. The stereochemistry of the β-amino group is specified as (βS), indicating the specific spatial arrangement of atoms around the chiral center, which can significantly affect the compound's biological activity and pharmacological profile. This substance may be of interest in medicinal chemistry and drug development, particularly in the context of designing compounds that interact with biological targets. Its properties, such as solubility, stability, and reactivity, would be influenced by the functional groups present and the overall molecular structure.
Formula:C8H11NO2S
InChI:InChI=1S/C8H11NO2S/c9-7(4-8(10)11)3-6-1-2-12-5-6/h1-2,5,7H,3-4,9H2,(H,10,11)/t7-/m0/s1
InChI key:InChIKey=AZWUDBISUBOQFK-ZETCQYMHSA-N
SMILES:O=C(O)CC(N)CC1=CSC=C1
- Synonyms:
- (3S)-3-amino-4-thiophen-3-ylbutanoic acid hydrochloride
- (S)-3-Amino-4-(3-Thienyl)Butanoic Acid Hydrochloride
- (βS)-β-Amino-3-thiophenebutanoic acid
- 3-Thiophenebutanoic acid, β-amino-, (βS)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | (S)-3-AMINO-4-(3-THIENYL)BUTANOIC ACID HYDROCHLORIDE REF: IN-DA00BCXBCAS: 270262-99-2 | - - - | To inquire | Mon 14 Apr 25 |
 | (3-Thienyl)-L-b-homoalanine REF: 10-F493436CAS: 270262-99-2 | 97% | - - - | Discontinued product |
 | (S)-3-Amino-4-(3-thienyl)butanoic acid REF: 3D-FA50180CAS: 270262-99-2 | Min. 95% | - - - | Discontinued product |
(S)-3-AMINO-4-(3-THIENYL)BUTANOIC ACID HYDROCHLORIDE
Ref: IN-DA00BCXB
| Undefined size | To inquire |
Ref: 10-F493436
| 1g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
(S)-3-Amino-4-(3-thienyl)butanoic acid
Ref: 3D-FA50180
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
