
CAS 270263-08-6
:(3S)-3-Amino-6-phenyl-5-hexenoic acid
Description:
(3S)-3-Amino-6-phenyl-5-hexenoic acid, with the CAS number 270263-08-6, is an amino acid derivative characterized by its unique structure that includes a phenyl group and a hexenoic acid backbone. This compound features a chiral center at the third carbon, which contributes to its stereochemistry and potential biological activity. The presence of the amino group (-NH2) makes it a basic compound, while the carboxylic acid group (-COOH) imparts acidic properties. The phenyl group enhances its hydrophobic character, influencing its solubility and interactions in biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug design. Its structural features suggest potential applications in the synthesis of peptides or as a building block in the development of novel therapeutic agents. Understanding its reactivity and interactions with other biomolecules is crucial for exploring its role in biological systems and potential therapeutic uses.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c13-11(9-12(14)15)8-4-7-10-5-2-1-3-6-10/h1-7,11H,8-9,13H2,(H,14,15)/t11-/m0/s1
InChI key:InChIKey=BYMYELCZQGMMKN-NSHDSACASA-N
SMILES:C(=CC[C@@H](CC(O)=O)N)C1=CC=CC=C1
Synonyms:- (3S)-3-Amino-6-phenyl-5-hexenoic acid
- 5-Hexenoic acid, 3-amino-6-phenyl-, (3S)-
- (S)-3-Amino-6-phenyl-5-hexenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
