CymitQuimica logo

CAS 2704-30-5

:

(2E)-2-(carbamoylhydrazono)propanoic acid

Description:
(2E)-2-(carbamoylhydrazono)propanoic acid, with the CAS number 2704-30-5, is an organic compound characterized by its unique structural features. It contains a propanoic acid backbone with a hydrazone functional group, which is formed by the reaction of a hydrazine derivative with a carbonyl compound. This compound typically exhibits both acidic and basic properties due to the presence of the carboxylic acid group and the hydrazone moiety. It is likely to be soluble in polar solvents, such as water and alcohols, owing to its ability to form hydrogen bonds. The compound may also display biological activity, making it of interest in pharmaceutical research. Its stability can be influenced by pH and temperature, and it may undergo various chemical reactions, including hydrolysis and condensation. Overall, (2E)-2-(carbamoylhydrazono)propanoic acid serves as a valuable compound in organic synthesis and medicinal chemistry.
Formula:C4H7N3O3
InChI:InChI=1/C4H7N3O3/c1-2(3(8)9)6-7-4(5)10/h1H3,(H,8,9)(H3,5,7,10)/b6-2+
Synonyms:
  • (2E)-2-(2-carbamoylhydrazinylidene)propanoic acid
  • propanoic acid, 2-[2-(aminocarbonyl)hydrazinylidene]-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.