CAS 27041-17-4

2-Bromoperfluoronaphthalene

Description:

2-Bromoperfluoronaphthalene is a perfluorinated aromatic compound characterized by the presence of bromine and fluorine substituents on a naphthalene backbone. Its molecular structure features a naphthalene ring system where hydrogen atoms are replaced by fluorine atoms, enhancing its chemical stability and hydrophobicity. The bromine atom introduces a polar functional group, which can influence its reactivity and solubility in various solvents. This compound is typically colorless to pale yellow and exhibits low volatility due to its high molecular weight and strong C-F bonds. It is known for its applications in organic synthesis, particularly in the development of fluorinated materials and as a potential intermediate in the production of specialty chemicals. Additionally, 2-Bromoperfluoronaphthalene may exhibit unique properties such as high thermal stability and resistance to chemical degradation, making it suitable for use in demanding environments. However, due to its perfluorinated nature, environmental and health considerations regarding its persistence and bioaccumulation are important factors in its handling and application.

Formula: C₁₀BrF₇

InChI: InChI=1S/C10BrF7/c11-3-4(12)1-2(5(13)8(3)16)7(15)10(18)9(17)6(1)14

SMILES: c12c(c(c(c(c1F)Br)F)F)c(c(c(c2F)F)F)F

Synonyms:

• 2-Bromo-1,3,4,5,6,7,8-heptafluoronaphthalene
• 2-Bromoheptafluoronaphthalene

2-Bromoheptafluoronaphthalene

CAS: 27041-17-4

Formula: C₁₀BrF₇

Purity: 95%

Color and Shape: Solid

Molecular weight: 332.9998

Ref: IN-DA00BBKW

2-Bromoheptafluoronaphthalene

CAS: 27041-17-4

2-Bromoheptafluoronaphthalene

Formula: C₁₀BrF₇

Purity: 85%

Color and Shape: off-white solid

Molecular weight: 333.00g/mol

Ref: 54-PC7930

2-Bromo-1,3,4,5,6,7,8-heptafluoronaphthalene

CAS: 27041-17-4

2-Bromo-1,3,4,5,6,7,8-Heptafluoronaphthalene is a monocyclic naphthalene with an acidic hydroxyl group. It is an electrophile that is activated by electron-withdrawing fluorine substituents and nucleophilic thiolate groups. 2-Bromo-1,3,4,5,6,7,8-Heptafluoronaphthalene forms a series of eight compounds with the same molecular formula but different structures. These isomers have similar properties to each other and can be used in the same way. The interaction between different isomers of 2-bromo-1,3,4,5,6,7,8-heptafluoronaphthalene and their corresponding cocatalyst determines which compound will form. 2-Bromo-1,3,4 5 6

Formula: C₁₀BrF₇

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 333 g/mol

Ref: 3D-FB88327

2-Bromo-1,3,4,5,6,7,8-heptafluoronaphthalene

CAS: 27041-17-4

Formula: C₁₀BrF₇

Purity: 95%

Color and Shape: Solid

Molecular weight: 333.003

Ref: 10-F234879

2-Bromoheptafluoronaphthalene

Controlled Product

CAS: 27041-17-4

Formula: C₁₀BrF₇

Color and Shape: Neat

Molecular weight: 333.0

Ref: TR-B687893