CAS 27048-01-7

{3-[(iodoacetyl)amino]-2,2,5,5-tetramethylpyrrolidin-1-yl}oxidanyl

Description:

The chemical substance known as {3-[(iodoacetyl)amino]-2,2,5,5-tetramethylpyrrolidin-1-yl}oxidanyl, with the CAS number 27048-01-7, is characterized by its complex structure that includes a pyrrolidine ring substituted with various functional groups. The presence of an iodoacetyl group suggests that it has potential reactivity due to the electrophilic nature of the iodine atom, which can participate in nucleophilic substitution reactions. The tetramethyl substitution indicates steric hindrance, which may influence its reactivity and interactions with other molecules. Additionally, the presence of an oxidanyl (hydroxyl) group contributes to its potential as a polar compound, affecting its solubility in various solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features could also lead to specific applications in organic synthesis or as a reagent in chemical reactions. Overall, the compound's characteristics are defined by its functional groups, steric effects, and potential reactivity.

Formula: C₁₀H₁₈IN₂O₂

InChI: InChI=1/C10H18IN2O2/c1-9(2)5-7(12-8(14)6-11)10(3,4)13(9)15/h7H,5-6H2,1-4H3,(H,12,14)

SMILES: CC1(C)CC(C(C)(C)N1O)N=C(CI)O

3-(2-IODOACETAMIDO)-PROXYL

CAS: 27048-01-7

Formula: C₁₀H₁₈IN₂O₂

Color and Shape: Solid

Molecular weight: 325.1666

Ref: IN-DA003I0W

3-(2-Iodoacetamido)-PROXYL

Controlled Product

CAS: 27048-01-7

Stability Light sensitive
Applications The insertion of this spin Labelled compound into RNA enables the study of RNA - protein complexes.
References Ramos, A. and Varani, G.: J. Am. Chem. Soc., 120, 10992-10993 (1998)

Formula: C₁₀H₁₈IN₂O₂

Color and Shape: Neat

Molecular weight: 325.17

Ref: TR-I684000