CAS 27049-45-2
:2-phenyl-1-(pyridin-2-yl)ethanone
Description:
2-Phenyl-1-(pyridin-2-yl)ethanone, also known as a ketone, is an organic compound characterized by the presence of both a phenyl group and a pyridine ring attached to a central ethanone structure. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic components. The presence of the ketone functional group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the aromatic rings can engage in π-π stacking interactions, influencing its physical properties and potential applications in materials science and pharmaceuticals. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Overall, 2-phenyl-1-(pyridin-2-yl)ethanone is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C13H11NO
InChI:InChI=1/C13H11NO/c15-13(12-8-4-5-9-14-12)10-11-6-2-1-3-7-11/h1-9H,10H2
InChI key:WTYYKZLGTHPLPZ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CC(=O)c1ccccn1
Synonyms:- Ethanone, 2-Phenyl-1-(2-Pyridinyl)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Phenyl-1-(pyridin-2-yl)ethanone
CAS:2-Phenyl-1-(pyridin-2-yl)ethanoneFormula:C13H11NOPurity:94%Color and Shape:LiquidMolecular weight:197.232542-Phenyl-1-(pyridin-2-yl)ethanone
CAS:Formula:C13H11NOPurity:95%Color and Shape:SolidMolecular weight:197.23252-Phenyl-1-(pyridin-2-yl)ethanone
CAS:2-Phenyl-1-(pyridin-2-yl)ethanone (2PPE) is a reactive methylene compound that can be used as a calibration standard for the determination of enolate equivalents in organomercurials. 2PPE reacts with azides to form a fluorescent product and undergoes boron trifluoride etherate mediated cleavage of its C(sp3)-H bond, yielding an alkyl azide intermediate. The reaction rate of 2PPE has been shown to be dependent on the carbonyl group and to be faster in the presence of fluorine. The kinetic data obtained from this experiment are used to calculate the β-unsaturated ketones concentration in mineralization reactions.
Formula:C13H11NOPurity:Min. 95%Molecular weight:197.24 g/mol



