CAS 270596-40-2
:Fmoc-(S)-3-amino-4-(3-chloro-phenyl)-butyric acid
Description:
Fmoc-(S)-3-amino-4-(3-chloro-phenyl)-butyric acid is a chemical compound commonly used in peptide synthesis and drug development. It features a fluorene-9-methoxycarbonyl (Fmoc) protecting group, which is widely utilized in solid-phase peptide synthesis due to its stability under basic conditions and ease of removal under mild acidic conditions. The compound contains an amino acid structure with a chiral center, specifically the (S)-enantiomer, which is crucial for biological activity and specificity in pharmacological applications. The presence of a 3-chloro-phenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically characterized by its molecular weight, solubility in organic solvents, and stability under various conditions. Its synthesis and application are of interest in medicinal chemistry, particularly in the development of peptide-based therapeutics. As with many amino acid derivatives, it is essential to handle this compound with care, following appropriate safety protocols due to potential toxicity associated with its chlorinated aromatic component.
Formula:C25H22ClNO4
InChI:InChI=1/C25H22ClNO4/c26-17-7-5-6-16(12-17)13-18(14-24(28)29)27-25(30)31-15-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-12,18,23H,13-15H2,(H,27,30)(H,28,29)/t18-/m0/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@@H](Cc1cccc(c1)Cl)CC(=O)O)O
Synonyms:- (3S)-4-(3-chlorophenyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Fmoc-(s)-3-amino-4-(3-chloro-phenyl)-butyric acid
CAS:Formula:C25H22ClNO4Purity:98%Color and Shape:SolidMolecular weight:435.8995Fmoc-(S)-3-amino-4-(3-chlorophenyl)-butyric acid
CAS:Fmoc-(S)-3-amino-4-(3-chlorophenyl)-butyric acidPurity:98%Molecular weight:435.90g/molFmoc-(S)-3-amino-4-(3-chlorophenyl)-butyric acid
CAS:Purity:98%Color and Shape:SolidMolecular weight:435.8999939Fmoc-3-chloro-L-beta-homophenylalanine
CAS:Fmoc-3-chloro-L-beta-homophenylalanine is a chemical scaffold that can be used in research, as an intermediate, or as a building block. It has a wide range of utility and can be used to create complex compounds with high purity. This product is sold as a solid that is soluble in organic solvents such as dichloromethane, chloroform, and DMF. Fmoc-3-chloro-L-beta-homophenylalanine is also known by its CAS number 270596-40-2.
Formula:C25H22ClNO4Purity:Min. 95%Color and Shape:White PowderMolecular weight:435.9 g/mol



