CAS 270596-53-7
:(S)-3-amino-4-(4-fluoro-phenyl)-butyric acid-HCl
Description:
(S)-3-amino-4-(4-fluoro-phenyl)-butyric acid-HCl, with the CAS number 270596-53-7, is a hydrochloride salt of a chiral amino acid derivative. This compound features a central carbon atom bonded to an amino group, a carboxylic acid group, and a phenyl ring substituted with a fluorine atom, contributing to its unique properties. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The chiral nature of this compound suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of drugs that modulate neurotransmitter systems. Its structural characteristics may also influence its stability, reactivity, and pharmacokinetic properties, which are critical for its potential therapeutic uses.
Formula:C10H13ClFNO2
InChI:InChI=1/C10H12FNO2.ClH/c11-8-3-1-7(2-4-8)5-9(12)6-10(13)14;/h1-4,9H,5-6,12H2,(H,13,14);1H/t9-;/m0./s1
SMILES:c1cc(ccc1C[C@@H](CC(=O)O)N)F.Cl
Synonyms:- L-3-Amino-4-(4-fluorophenyl)-butyric acid hydrochloride
- (3S)-3-amino-4-(4-fluorophenyl)butanoic acid hydrochloride
- H-β-HoPhe(4-F)-OH.HCl
- (S)-3-Amino-4-(4-Fluorophenyl)Butanoic Acid Hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
