CAS 27069-17-6
:5-(4-methoxyphenyl)-1H-pyrazole
Description:
5-(4-Methoxyphenyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a 4-methoxyphenyl group at the 5-position of the pyrazole ring contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents due to its aromatic structure, while its polar methoxy group can enhance interactions with polar solvents. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure allows for potential hydrogen bonding and π-π stacking interactions, which can influence its reactivity and interactions with biological targets. Additionally, its stability under standard conditions makes it suitable for various synthetic applications. As with many pyrazole derivatives, it may undergo typical reactions such as electrophilic substitution or nucleophilic attack, depending on the substituents present. Overall, 5-(4-methoxyphenyl)-1H-pyrazole is a versatile compound with potential applications in research and industry.
Formula:C10H10N2O
InChI:InChI=1/C10H10N2O/c1-13-9-4-2-8(3-5-9)10-6-7-11-12-10/h2-7H,1H3,(H,11,12)
SMILES:COc1ccc(cc1)c1cc[nH]n1
Synonyms:- 1H-Pyrazole, 3-(4-methoxyphenyl)-
- 3-(4-Methoxyphenyl)-1H-pyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(4-Methoxyphenyl)-1H-pyrazole
CAS:Formula:C10H10N2OPurity:95%Color and Shape:SolidMolecular weight:174.19923-(4-Methoxyphenyl)-1H-pyrazole
CAS:3-(4-Methoxyphenyl)-1H-pyrazolePurity:≥95%Color and Shape:PowderMolecular weight:174.20g/mol3-(4-Methoxyphenyl)pyrazole
CAS:Formula:C10H10N2OPurity:95%Color and Shape:SolidMolecular weight:174.2033-(4-Methoxyphenyl)pyrazole
CAS:3-(4-Methoxyphenyl)pyrazole is a fungicide that belongs to the group of nitrophenol derivatives. It inhibits the growth of plant pathogenic fungi by inhibiting the synthesis of proteins and nucleic acids. 3-(4-Methoxyphenyl)pyrazole has an inhibitory effect on seed germination and germination, as well as on hydroxymethylation reactions in fungal mycelia. 3-(4-Methoxyphenyl)pyrazole also has bactericidal properties and can be used for controlling bacteria in water systems.
Formula:C10H10N2OPurity:Min. 95%Molecular weight:174.2 g/mol



