CymitQuimica logo

CAS 27079-92-1

:

4-(Bromomethyl)phenol

Description:
4-(Bromomethyl)phenol, with the CAS number 27079-92-1, is an organic compound characterized by the presence of a bromomethyl group (-CH2Br) attached to a phenolic ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic phenolic structure. It exhibits properties typical of both phenols and alkyl halides, making it a useful intermediate in organic synthesis. The bromomethyl group can participate in nucleophilic substitution reactions, allowing for further functionalization of the molecule. Additionally, the phenolic hydroxyl group (-OH) can engage in hydrogen bonding, influencing its reactivity and interactions with other chemical species. 4-(Bromomethyl)phenol is often utilized in the synthesis of various pharmaceuticals, agrochemicals, and other organic compounds, highlighting its significance in chemical research and industrial applications. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C7H7BrO
InChI:InChI=1/C7H7BrO/c8-5-6-1-3-7(9)4-2-6/h1-4,9H,5H2
Synonyms:
  • phenol, 4-(bromomethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.