CAS 27089-56-1
:2-Thio-6-azauridine
Description:
2-Thio-6-azauridine is a nucleoside analog characterized by the presence of a sulfur atom in the ribose moiety, which distinguishes it from standard nucleosides. This compound features a pyrimidine base, specifically uracil, modified at the 6-position with an azole group, contributing to its unique chemical properties. The presence of the thio group enhances its potential for biological activity, particularly in antiviral and anticancer research, as it can interfere with nucleic acid synthesis. 2-Thio-6-azauridine is soluble in water and exhibits stability under physiological conditions, making it a candidate for therapeutic applications. Its mechanism of action typically involves incorporation into RNA, leading to disruption of normal cellular processes. Additionally, the compound's structural modifications may influence its binding affinity to enzymes and receptors, further impacting its biological efficacy. Overall, 2-Thio-6-azauridine represents a significant area of study in medicinal chemistry, particularly in the development of novel therapeutic agents targeting viral infections and cancer.
Formula:C8H11N3O5S
InChI:InChI=1/C8H11N3O5S/c12-2-3-5(14)6(15)7(16-3)11-8(17)10-4(13)1-9-11/h1,3,5-7,12,14-15H,2H2,(H,10,13,17)/t3-,5-,6-,7-/m1/s1
InChI key:InChIKey=TVCBDTCUOVDLNZ-SHUUEZRQSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=S)NC(=O)C=N2
Synonyms:- 3,4-Dihydro-2-β-D-ribofuranosyl-3-thioxo-1,2,4-triazin-5(2H)-one
- 1-β-D-Ribofuranosyl-2-thio-6-azauracil
- 2-Thio-6-azauridine
- as-Triazine-3,5(2H,4H)-dione, 2-β-D-ribofuranosyl-3-thio-
- 1,2,4-Triazin-5(2H)-one, 3,4-dihydro-2-β-D-ribofuranosyl-3-thioxo-
- 1-beta-D-Ribofuranosyl-2-thio-6-azauracil
- 1,2,4-Triazin-5(2H)-one, 3,4-dihydro-2-2-D-ribofuranosyl-3-thioxo-
- 6-aza-2-thiouridine
- (2,3,4,5-tetrahydro)-3-thioxo-2-(beta-D-ribofuranosyl)-1,2,4-triazin-5-one
- 2,3-Dihydro-2-(β-D-ribofuranosyl)-3-thioxo-1,2,4-triazine-5(4H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2,4-Triazin-5(2H)-one,3,4-dihydro-2-b-D-ribofuranosyl-3-thioxo-
CAS:Formula:C8H11N3O5SPurity:97%Color and Shape:SolidMolecular weight:261.25506-Aza-2-thiouridine
CAS:Formula:C8H11N3O5SPurity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:261.266-Aza-2-thiouridine
CAS:6-Aza-2-thiouridine is a molecule that has been shown to inhibit human immunodeficiency virus (HIV). The compound is cytotoxic to leukemia cells and selectively inhibits the function of cytidine deaminase, which is an enzyme required for DNA synthesis. 6-Aza-2-thiouridine also inhibits the production of viruses by interfering with the activity of their nucleic acid polymerases. This inhibition may be due to its ability to hydrolyze extracellular hydroxyl groups on the viral nucleotide. 6-Aza-2-thiouridine has also been shown to have anti-cancer properties in mammalian cells.
Formula:C8H11N3O5SPurity:Min. 95%Color and Shape:White PowderMolecular weight:261.26 g/mol6-Aza-2-thiouridine
CAS:Controlled ProductFormula:C8H10N3NaO5SColor and Shape:NeatMolecular weight:283.237





