CAS 270912-79-3

[(5-bromopyrimidin-2-yl)oxy]acetic acid

Description:

[(5-bromopyrimidin-2-yl)oxy]acetic acid is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a bromine atom at the 5-position and an ether linkage to an acetic acid moiety. This compound typically exhibits properties associated with both heterocyclic compounds and carboxylic acids. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The bromine substituent may influence its reactivity and biological activity, potentially making it useful in medicinal chemistry or as a building block in organic synthesis. The compound may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used to confirm its structure. Overall, [(5-bromopyrimidin-2-yl)oxy]acetic acid represents a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₆H₅BrN₂O₃

InChI: InChI=1/C6H5BrN2O3/c7-4-1-8-6(9-2-4)12-3-5(10)11/h1-2H,3H2,(H,10,11)

SMILES: c1c(cnc(n1)OCC(=O)O)Br

Synonyms:

• Acetic Acid, 2-[(5-Bromo-2-Pyrimidinyl)Oxy]-
• [(5-Bromopyrimidin-2-yl)oxy]acetic acid

(5-BROMO-PYRIMIDIN-2-YLOXY)-ACETIC ACID

CAS: 270912-79-3

Formula: C₆H₅BrN₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 233.0195

Ref: IN-DA00BIN7

2-((5-Bromopyrimidin-2-yl)oxy)acetic acid

CAS: 270912-79-3

2-((5-Bromopyrimidin-2-yl)oxy)acetic acid

Purity: 95%

Molecular weight: 233.02g/mol

Ref: 54-OR91538

2-((5-Bromopyrimidin-2-yl)oxy)acetic acid

CAS: 270912-79-3

Formula: C₆H₅BrN₂O₃

Purity: 98%

Molecular weight: 233.021

Ref: 10-F376341