CymitQuimica logo

CAS 27106-12-3

:

4-phenyl-5-thioxo-1,2,4-triazolidin-3-one

Description:
4-Phenyl-5-thioxo-1,2,4-triazolidin-3-one is a heterocyclic compound characterized by its triazolidinone structure, which includes a five-membered ring containing three nitrogen atoms and two carbon atoms. The presence of a phenyl group contributes to its aromatic properties, while the thioxo group (a sulfur atom double-bonded to a carbon atom) enhances its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. It is of interest in medicinal chemistry due to its potential pharmacological applications, including antimicrobial and anti-inflammatory activities. The compound's reactivity can be influenced by the functional groups present, making it a candidate for further chemical modifications. As with many triazolidinones, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which can be exploited in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H7N3OS
InChI:InChI=1/C8H7N3OS/c12-7-9-10-8(13)11(7)6-4-2-1-3-5-6/h1-5H,(H,9,12)(H,10,13)
InChI key:RAOXPTJDYMBTGU-UHFFFAOYSA-N
SMILES:c1ccc(cc1)n1c(nnc1S)O
Synonyms:
  • 3H-1,2,4-triazol-3-one, 2,4-dihydro-5-mercapto-4-phenyl-
  • 1,2,4-Triazolidin-3-one,4-phenyl-5-thioxo-
Found 3 products.