CAS 27106-16-7

5-(furan-2-yl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-(Furan-2-yl)-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a heterocyclic compound characterized by the presence of a triazole ring, which is a five-membered ring containing three nitrogen atoms. This compound features a furan moiety, a five-membered aromatic ring containing oxygen, and a phenyl group, contributing to its structural complexity and potential reactivity. The thione functional group (–C=S) indicates the presence of a sulfur atom double-bonded to a carbon atom, which can influence the compound's chemical behavior, including its reactivity and stability. This substance may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for various interactions with biological targets, potentially leading to applications in pharmaceuticals. Additionally, the presence of multiple functional groups suggests that it may participate in diverse chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₂H₉N₃OS

InChI: InChI=1/C12H9N3OS/c17-12-14-13-11(10-7-4-8-16-10)15(12)9-5-2-1-3-6-9/h1-8H,(H,14,17)

SMILES: c1ccc(cc1)n1c(c2ccco2)nnc1S

Synonyms:

• 3-(2-furyl)-4-phenyl-4,5-dihydro-1H-1,2,4-triazole-5-thione
• 4H-1,2,4-Triazole-3-thiol, 5-(2-furanyl)-4-phenyl-
• 5-(2-Furyl)-4-phenyl-4H-1,2,4-triazole-3-thiol

5-(Furan-2-yl)-4-phenyl-4H-1,2,4-triazole-3-thiol

CAS: 27106-16-7

Versatile small molecule scaffold

Formula: C₁₂H₉N₃OS

Purity: Min. 95%

Molecular weight: 243.29 g/mol

Ref: 3D-CBA10616