CAS 271241-14-6
:Dimefluthrin
Description:
Dimefluthrin is a synthetic pyrethroid insecticide known for its effectiveness against a wide range of pests. It is characterized by its high potency and rapid knockdown effect, making it a popular choice in both agricultural and household pest control applications. Dimefluthrin exhibits low toxicity to mammals and birds, which contributes to its favorable safety profile when used according to guidelines. The compound is typically formulated as a liquid or aerosol and is designed to target the nervous system of insects, leading to paralysis and death. Its chemical structure includes a phenoxy group and a cyano group, which are essential for its insecticidal activity. Dimefluthrin is also noted for its stability under various environmental conditions, although it can degrade in the presence of sunlight and moisture. As with many pesticides, proper handling and application are crucial to minimize potential environmental impact and ensure safety for non-target organisms.
Formula:C19H22F4O3
InChI:InChI=1/C19H22F4O3/c1-9(2)6-12-13(19(12,3)4)18(24)26-8-11-16(22)14(20)10(7-25-5)15(21)17(11)23/h6,12-13H,7-8H2,1-5H3
SMILES:CC(=CC1C(C(=O)OCc2c(c(c(COC)c(c2F)F)F)F)C1(C)C)C
Synonyms:- [2,3,5,6-Tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate
- 2,3,5,6-Tetrafluoro-4-(Methoxymethyl)Benzyl 2,2-Dimethyl-3-(2-Methylprop-1-En-1-Yl)Cyclopropanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Dimefluthrin
CAS:Controlled ProductFormula:C19H22F4O3Color and Shape:ColourlessMolecular weight:374.37
