CAS 27126-42-7
:ethyl 4-bromopentanoate
Description:
Ethyl 4-bromopentanoate is an organic compound classified as an ester, specifically derived from the reaction of 4-bromopentanoic acid and ethanol. Its molecular formula is C7H13BrO2, indicating the presence of a bromine atom, which contributes to its reactivity and potential applications in organic synthesis. The compound typically appears as a colorless to pale yellow liquid with a characteristic fruity odor. Ethyl 4-bromopentanoate is soluble in organic solvents such as ethanol and diethyl ether but has limited solubility in water due to its hydrophobic alkyl chain. It is often used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, as well as in the preparation of other chemical compounds through nucleophilic substitution reactions. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C7H13BrO2
InChI:InChI=1/C7H13BrO2/c1-3-10-7(9)5-4-6(2)8/h6H,3-5H2,1-2H3
SMILES:CCOC(=O)CCC(C)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 4-bromopentanoate
CAS:Formula:C7H13BrO2Purity:96%Color and Shape:LiquidMolecular weight:209.0809Ethyl 4-bromopentanoate
CAS:<p>Ethyl 4-bromopentanoate is an organic compound that belongs to the class of compounds called ketones. It is a colorless liquid with a fruity odor. The compound is used in the synthesis of polycyclic aromatic hydrocarbons, such as tetrahydrocarbazoles and adducts with dienophiles. This active form can be synthesized by Wittig reaction using dimethyl acetylenedicarboxylate and an annulated alkyl halide as the starting materials.</p>Formula:C7H13BrO2Purity:Min. 95%Molecular weight:209.08 g/mol
