CAS 27148-03-4
:1,2-benzisothiazole-3(2H)-thione 1,1-dioxide
Description:
1,2-Benzisothiazole-3(2H)-thione 1,1-dioxide, with the CAS number 27148-03-4, is a heterocyclic compound characterized by its benzothiazole core structure. This compound features a thione functional group, which is a sulfur-containing moiety, and is further oxidized to form a sulfone, indicated by the "1,1-dioxide" designation. It typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of both sulfur and nitrogen in its structure contributes to its unique chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound may exhibit biological activity, making it of interest in medicinal chemistry for the development of new therapeutic agents. Additionally, its structural features allow for potential interactions with biological targets, which can be explored in drug design and development. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C7H5NO2S2
InChI:InChI=1/C7H5NO2S2/c9-12(10)6-4-2-1-3-5(6)7(11)8-12/h1-4H,(H,8,11)
SMILES:c1ccc2c(c1)C(=NS2(=O)=O)S
Synonyms:- 3-sulfanyl-1,2-benzothiazole-1,1-dione
- Benzo[d]isothiazole-3(2H)-thione 1,1-dioxide
- 1,2-benzisothiazole-3-thiol 1,1-dioxide
- Thiosaccharin
- 1,2-benzisothiazol-3-(2H)-thione-1,1-dioxide
- 1,2-Benzisothiazole-3(2H)-thione 1,1-dioxide ISO 9001:2015 REACH
- 1,2-Benzisothiazole-3(2H)-thione 1,1-dioxide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2-Benzisothiazole-3(2H)-thione 1,1-dioxide
CAS:Formula:C7H5NO2S2Purity:95%Color and Shape:SolidMolecular weight:199.2501Benzo[d]isothiazole-3(2H)-thione 1,1-dioxide
CAS:Benzo[d]isothiazole-3(2H)-thione 1,1-dioxidePurity:95%Molecular weight:199.26g/molBenzo[d]isothiazole-3(2H)-thione 1,1-dioxide
CAS:Formula:C7H5NO2S2Purity:95.0%Color and Shape:Solid, No data available.Molecular weight:199.24Benzo[d]isothiazole-3(2H)-thione 1,1-dioxide
CAS:Benzo[d]isothiazole-3(2H)-thione 1,1-dioxide is a molecule that crystallizes as the sodium salt. The crystal structure was determined by x-ray diffraction and found to be orthorhombic with space group Pna2 1 . The molecular geometry was studied using experimental studies and calculated from the diffraction data. It has been shown that benzo[d]isothiazole-3(2H)-thione 1,1-doxide can form hydrogen bonds with water molecules in the crystal lattice. There are two possible geometries for this molecule: one where the hydrogen atom is above the plane of the thione ring, and one where it is below.Formula:C7H5NO2S2Purity:Min. 95%Molecular weight:199.24 g/mol



