CAS 271583-17-6

(2R)-amino(2-methoxyphenyl)ethanoic acid

Description:

(2R)-Amino(2-methoxyphenyl)ethanoic acid, also known as a derivative of phenylalanine, is an amino acid characterized by its specific stereochemistry and functional groups. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical of amino acids, allowing it to participate in various biochemical processes. The presence of a methoxy group (-OCH3) on the phenyl ring enhances its lipophilicity and may influence its interaction with biological targets. The (2R) designation indicates that the amino acid has a specific spatial arrangement, which is crucial for its biological activity and interaction with enzymes and receptors. This compound may exhibit properties such as solubility in polar solvents, and its structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or metabolic pathways. Its unique characteristics make it a subject of interest in medicinal chemistry and biochemistry research.

Formula: C₉H₁₁NO₃

InChI: InChI=1/C9H11NO3/c1-13-7-5-3-2-4-6(7)8(10)9(11)12/h2-5,8H,10H2,1H3,(H,11,12)/t8-/m1/s1

SMILES: COc1ccccc1[C@H](C(=O)O)N

Synonyms:

• 2-Amino-2-(2-Methoxyphenyl)Acetic Acid
• 2-(2-Methoxyphenyl)glycine

AMINO-(2-METHOXY-PHENYL)-ACETIC ACID

CAS: 271583-17-6

Formula: C₉H₁₁NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 181.1885

Ref: IN-DA00BCAQ

2-(2-Methoxyphenyl)glycine

CAS: 271583-17-6

2-(2-Methoxyphenyl)glycine

Purity: 95%

Molecular weight: 181.19g/mol

Ref: 54-OR912775

2-Amino-2-(2-methoxyphenyl)acetic acid

CAS: 271583-17-6

Formula: C₉H₁₁NO₃

Purity: 95%

Color and Shape: Solid, White powder

Molecular weight: 181.191

Ref: 10-F091648