CAS 2716-23-6
:bicyclo[2.2.2]octan-2-one
Description:
Bicyclo[2.2.2]octan-2-one, with the CAS number 2716-23-6, is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclic framework containing two fused cyclopropane rings and a ketone functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits a distinctive odor and is relatively stable under standard conditions. Bicyclo[2.2.2]octan-2-one is known for its potential applications in organic synthesis and as a building block in the development of various chemical compounds, including pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the carbonyl group, which can participate in various chemical reactions such as nucleophilic addition and condensation. Additionally, the compound's unique three-dimensional structure can impart interesting properties, making it a subject of study in the fields of medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H12O
InChI:InChI=1/C8H12O/c9-8-5-6-1-3-7(8)4-2-6/h6-7H,1-5H2
InChI key:VEPYQCZRVLNDBC-UHFFFAOYSA-N
SMILES:C1CC2CCC1CC2=O
Synonyms:- Bicyclo(2.2.2)octanone
- Bicyclo[2.2.2]octan-2-one
- BICYCLO[2. 2. 2]0CTAN-2-0NE
- bicyclo[2.2.2]octan-3-one
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Bicyclo[2.2.2]octan-2-one
CAS:Bicyclo[2.2.2]octan-2-oneFormula:C8H12OPurity:97%Molecular weight:124.18Bicyclo[2.2.2]octan-2-one
CAS:Bicyclo[2.2.2]octan-2-oneFormula:C8H12OPurity:97%Molecular weight:124.18Bicyclo[2.2.2]octan-2-one
CAS:Bicyclo[2.2.2]octan-2-one is an enolate that can be synthesized by the acetylation of ketones or by the reaction of nitrite ion with aldehydes. This compound has been shown to undergo stereoselective reactions, including borohydride reduction and carbonyl group activation. The bicyclic skeleton of this molecule is asymmetric, which allows for the synthesis of two different enolates. Bicyclo[2.2.2]octan-2-one predominately exists in its keto form, but does exist as a diketone under certain conditions. When exposed to light, bicyclo[2.2.2]octan-2-one will undergo photoelectron transfer from the carbonyl groups to produce an intramolecular hydrogen bond between the carbonyl oxygen and the hydroxyl oxygen of neighboring molecules, making it predominately a dikFormula:C8H12OPurity:Min. 95%Molecular weight:124.18 g/mol




