CAS 27174-07-8
:Coutaric acid
Description:
Coutaric acid is an organic compound classified as a phenolic acid, primarily derived from the bark of certain trees, particularly the Brazilian tree known as "Coutarea." It is characterized by its structure, which includes a carboxylic acid group and a phenolic hydroxyl group, contributing to its acidic properties. Coutaric acid is known for its potential antioxidant and anti-inflammatory activities, making it of interest in both pharmaceutical and cosmetic applications. The compound is typically found in a crystalline form and is soluble in organic solvents. Its chemical behavior is influenced by the presence of functional groups, allowing it to participate in various chemical reactions, including esterification and oxidation. Additionally, coutaric acid has been studied for its role in plant defense mechanisms and its potential health benefits when consumed. As with many phenolic compounds, it may exhibit antimicrobial properties, further enhancing its significance in natural product chemistry and potential therapeutic uses.
Formula:C13H12O8
InChI:InChI=1S/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3+/t10-,11-/m1/s1
InChI key:InChIKey=INYJZRKTYXTZHP-NNPIPJJVSA-N
SMILES:[C@@H](OC(/C=C/C1=CC=C(O)C=C1)=O)([C@H](C(O)=O)O)C(O)=O
Synonyms:- Butanedioic acid, 2-hydroxy-3-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propenyl]oxy]-, (2R,3R)-
- Butanedioic acid, 2-hydroxy-3-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-, (2R,3R)-
- Butanedioic acid, 2-hydroxy-3-[[3-(4-hydroxyphenyl)-1-oxo-2-propenyl]oxy]-, [R-[R*,R*-(E)]]-
- Cinnamic acid, p-hydroxy-, monoester with tartaric acid, (E)-(+)-
- Tartaric acid, mono(p-hydroxycinnamate), (E)-(+)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Trans-coutaric acid
CAS:Carboxylic acid with additional oxygen functionsFormula:C13H12O8Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:296.23Coutaric acid
CAS:Coutaric acid is a hydroxycinnamic acid derivative, which is found predominantly in grape juices and wines. It is sourced from the skin and seeds of grapes, where it exists as an ester of tartaric acid and caffeic acid. The mode of action of coutaric acid primarily involves its function as an antioxidant, neutralizing free radicals and thus protecting cellular components from oxidative damage.
Formula:C13H12O8Purity:Min. 95%Molecular weight:296.23 g/mol

