CAS 27174-71-6
:methyl tricyclo[3.3.1.1~3,7~]dec-1-ylacetate
Description:
Methyl tricyclo[3.3.1.1^3,7]dec-1-ylacetate is an organic compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. This compound features an acetate functional group, which contributes to its reactivity and solubility properties. The presence of the methyl ester group enhances its volatility and potential applications in organic synthesis and fragrance industries. Typically, compounds like this exhibit moderate polarity due to the ester functional group, influencing their solubility in various organic solvents. The tricyclic framework can impart rigidity to the molecule, affecting its conformational flexibility and interactions with biological systems. Methyl tricyclo[3.3.1.1^3,7]dec-1-ylacetate may also exhibit interesting chemical behavior, such as undergoing hydrolysis or transesterification under appropriate conditions. Its specific applications can vary, but it may be utilized in the synthesis of more complex organic molecules or as a flavoring agent due to its structural characteristics. As with many organic compounds, safety data should be consulted for handling and usage guidelines.
Formula:C13H20O2
InChI:InChI=1/C13H20O2/c1-15-12(14)8-13-5-9-2-10(6-13)4-11(3-9)7-13/h9-11H,2-8H2,1H3
SMILES:COC(=O)CC12CC3CC(CC(C3)C2)C1
Synonyms:- Methyl 2-(1-Adamantyl)Acetate
- Methyl adamantan-1-ylacetate
- Tricyclo[3.3.1.1~3,7~]Decane-1-Acetic Acid, Methyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 1-adamantylacetate
CAS:Methyl 1-adamantylacetate is a synthetic fluorinated solvent that is used in aerosols. It is also known as trichloromonofluoromethane. Methyl 1-adamantylacetate has been shown to be an extractable and trackable solute in human biofluids and exhaled air.Formula:C13H20O2Color and Shape:PowderMolecular weight:208.3 g/mol



