CAS 27182-54-3
:5-Phenyl-1,2,4-thiadiazol-3-amine
Description:
5-Phenyl-1,2,4-thiadiazol-3-amine is an organic compound characterized by its thiadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and one sulfur atom. This compound features a phenyl group attached to the thiadiazole, contributing to its aromatic properties and potential reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amino group (-NH2) at the 3-position of the thiadiazole ring suggests that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry. Additionally, compounds of this class may exhibit biological activity, which can be explored for applications in pharmaceuticals or agrochemicals. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on the purity and specific conditions under which it is studied. Safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C8H7N3S
InChI:InChI=1/C8H7N3S/c9-8-10-7(12-11-8)6-4-2-1-3-5-6/h1-5H,(H2,9,11)
SMILES:c1ccc(cc1)c1nc(=N)[nH]s1
Synonyms:- 1,2,4-Thiadiazol-3-Amine, 5-Phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Amino-5-phenyl-1,2,4-thiadiazole, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H7N3SPurity:96%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:177.235-Phenyl-1,2,4-thiadiazol-3-amine
CAS:Formula:C8H7N3SPurity:96%Color and Shape:SolidMolecular weight:177.22635-Phenyl-1,2,4-thiadiazol-3-amine
CAS:Formula:C8H7N3SPurity:95.0%Color and Shape:SolidMolecular weight:177.23


