CAS 2719-14-4
:N-(4-methyl-3-nitrophenyl)acetamide
Description:
N-(4-methyl-3-nitrophenyl)acetamide, with the CAS number 2719-14-4, is an organic compound characterized by its amide functional group attached to a substituted aromatic ring. The structure features a nitro group and a methyl group on the phenyl ring, which influence its chemical reactivity and physical properties. This compound typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. The presence of the nitro group contributes to its potential as a reactive intermediate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis often involves the acylation of an amine with an acetic acid derivative, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Safety precautions should be observed when handling this compound due to potential toxicity associated with nitro-substituted aromatic compounds.
Formula:C9H10N2O3
InChI:InChI=1/C9H10N2O3/c1-6-3-4-8(10-7(2)12)5-9(6)11(13)14/h3-5H,1-2H3,(H,10,12)
InChI key:InChIKey=XYTSBFSNPUGBIH-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC(N(=O)=O)=C(C)C=C1
Synonyms:- 2-Nitro-4-(acetylamino)toluene
- 2-Nitro-4-acetamidotoluene
- 3′-Nitro-p-acetotoluidide
- 4-(N-Acetylamino)-2-nitrotoluene
- 4-Acetamido-2-nitrotoluene
- 4-Acetylamino-2-nitrotoluene
- 4-Methyl-3-nitroacetanilide
- Acetamide, N-(4-methyl-3-nitrophenyl)-
- Acetamide, N-(4-methyl-3-nitrophenyl)- (9CI)
- Nsc 202380
- Nsc 86673
- p-Acetotoluidide, 3'-nitro- (8CI)
- p-Acetotoluidide, 3′-nitro-
- N-(4-Methyl-3-nitrophenyl)acetamide
- 3'-Nitro-4'-methylacetoanilide
- N-(3-Nitro-4-methylphenyl)acetamide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Methyl-4-nitro-N-acetylbenzeneamine
CAS:Formula:C9H10N2O3Purity:98%Color and Shape:SolidMolecular weight:194.18734'-Methyl-3'-nitroacetanilide
CAS:4'-Methyl-3'-nitroacetanilidePurity:≥95%Color and Shape:PowderMolecular weight:194.19g/molN-(4-Methyl-3-nitrophenyl)acetamide
CAS:3-Methyl-4-nitro-N-acetylbenzeneamine is a biodegradable chemical that acts as an inhibitor of the growth rate of bacteria in wastewater treatment. It has been shown to be effective in both aerobic and anaerobic environments. 3-Methyl-4-nitro-N-acetylbenzeneamine is a racemic mixture, consisting of two isomers that are easily separated by chromatography. The primary mechanism for degradation of this chemical is acetylation, which converts it into acetic acid and methyl acetate. 3-Methyl-4-nitro-N-acetylbenzeneamine can also be degraded by aerobic soil bacteria with the help of fatty acids. This chemical is not toxic to humans or animals and does not affect crop plants.br>Formula:C9H10N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:194.19 g/mol



