CAS 2719-23-5
:N-2-Thiazolylacetamide
Description:
N-2-Thiazolylacetamide, with the CAS number 2719-23-5, is an organic compound characterized by the presence of a thiazole ring and an acetamide functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, which is common for amides. The thiazole moiety contributes to its potential biological activity, as thiazoles are known for their presence in various pharmaceuticals and agrochemicals. N-2-Thiazolylacetamide may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which can be explored in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards in laboratory or industrial settings. Overall, N-2-Thiazolylacetamide represents a versatile compound with applications in various fields of research.
Formula:C5H6N2OS
InChI:InChI=1S/C5H6N2OS/c1-4(8)7-5-6-2-3-9-5/h2-3H,1H3,(H,6,7,8)
InChI key:InChIKey=WXPLRSVMGRAIGW-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=NC=CS1
Synonyms:- 2-(Methylcarbonylamino)thiazole
- 2-Acetamido-1,3-thiazole
- 2-Acetamidothiazole
- Acetamide, N-2-thiazolyl-
- N-(1,3-thiazol-2-yl)acetamide
- N-2-Thiazolylacetamide
- N-thiazol-2-ylacetamide
- NSC 18750
- NSC 44844
- Thiazole, 2-acetamido-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Acetamidothiazole
CAS:Formula:C5H6N2OSPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:142.182-Acetamido-1,3-thiazole
CAS:2-Acetamido-1,3-thiazoleFormula:C5H6N2OSPurity:98%Color and Shape: beige solidMolecular weight:142.18g/mol2-Acetamidothiazole
CAS:2-Acetamidothiazole is an anion that can be synthesized from acetamide and thiourea. It has been shown to have anticancer activity in a number of different cancer cells, with the most potent activity found in human lung carcinoma cell lines. 2-Acetamidothiazole has also shown antibacterial properties against Gram-positive bacteria. The mechanism of action is unclear, but it may involve the inhibition of phosphatidylinositol-3 kinase (PI3K) or other enzymes that are involved in bacterial growth. 2-Acetamidothiazole has been used as a ligand for coordination geometry studies and X-ray crystal structures. It also has organometallic properties and can act as a catalyst for amide synthesis reactions.Formula:C5H6N2OSPurity:Min. 95%Color and Shape:PowderMolecular weight:142.18 g/mol2-Acetamidothiazole
CAS:2-Acetamidothiazole is a useful organic compound for research related to life sciences. The catalog number is T67350 and the CAS number is 2719-23-5.Formula:C5H6N2OSColor and Shape:SolidMolecular weight:142.18






