CAS 2719-63-3
:5-Phenyldodecane
Description:
5-Phenyldodecane is an organic compound classified as an alkyl-substituted aromatic hydrocarbon. It features a dodecane backbone, which consists of a straight-chain of twelve carbon atoms, with a phenyl group (a benzene ring) attached to the fifth carbon of the chain. This structure contributes to its unique physical and chemical properties. The compound is typically a colorless to pale yellow liquid at room temperature and is insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. Its molecular formula is C18H30, indicating a relatively high molecular weight and a significant degree of saturation. 5-Phenyldodecane is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of surfactants, lubricants, and other chemical intermediates. Additionally, its behavior in different chemical environments can be studied to understand its reactivity and interactions with other substances. Safety data should be consulted for handling and exposure guidelines, as with any chemical compound.
Formula:C18H30
InChI:InChI=1S/C18H30/c1-3-5-7-8-10-14-17(13-6-4-2)18-15-11-9-12-16-18/h9,11-12,15-17H,3-8,10,13-14H2,1-2H3
InChI key:InChIKey=NPAWGLOPXKCTCV-UHFFFAOYSA-N
SMILES:C(CCCCCCC)(CCCC)C1=CC=CC=C1
Synonyms:- 5-Phenyldodecane
- Dodecane, 5-phenyl-
- (1-Butyloctyl)benzene
- Benzene, (1-butyloctyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
