CymitQuimica logo

CAS 272-12-8

:

Thieno[2,3-c]pyridine

Description:
Thieno[2,3-c]pyridine is a heterocyclic organic compound characterized by a fused ring system that incorporates both a thiophene and a pyridine moiety. This compound features a five-membered thiophene ring fused to a six-membered pyridine ring, resulting in a bicyclic structure. It is typically a colorless to pale yellow solid with a distinctive aromatic character, contributing to its potential applications in pharmaceuticals and organic synthesis. Thieno[2,3-c]pyridine exhibits moderate solubility in polar organic solvents and is relatively stable under standard conditions. Its chemical properties allow for various substitutions, making it a versatile building block in the synthesis of more complex molecules. The compound is of interest in medicinal chemistry due to its biological activity, including potential anti-inflammatory and anti-cancer properties. Additionally, it can participate in various chemical reactions, such as electrophilic aromatic substitution and nucleophilic addition, making it valuable in synthetic organic chemistry. Overall, thieno[2,3-c]pyridine is a significant compound in both academic research and industrial applications.
Formula:C7H5NS
InChI:InChI=1S/C7H5NS/c1-3-8-5-7-6(1)2-4-9-7/h1-5H
InChI key:InChIKey=GDQBPBMIAFIRIU-UHFFFAOYSA-N
SMILES:C1=2C(SC=C1)=CN=CC2
Synonyms:
  • 6-Azabenzo[b]thiophene
  • 6-Azathianaphthene
  • NSC 152396
  • Thieno(2,3-c)pyridine
  • Thieno[2,3-c]pyridine
  • Thieno[2,3-c]pyridine
Found 5 products.