CymitQuimica logo

CAS 272-60-6

:

1H-pyrazolo[3,4-b]pyrazine

Description:
1H-pyrazolo[3,4-b]pyrazine is a heterocyclic organic compound characterized by its fused pyrazole rings, which contribute to its unique chemical properties. It has a molecular formula that reflects its structure, consisting of carbon, hydrogen, and nitrogen atoms. This compound is typically a solid at room temperature and exhibits a pale yellow to off-white appearance. It is known for its potential biological activities, making it of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in its structure can influence its reactivity and solubility, often making it a candidate for various chemical reactions, including those involving nucleophiles and electrophiles. Additionally, 1H-pyrazolo[3,4-b]pyrazine can serve as a building block in the synthesis of more complex molecules. Its derivatives may exhibit diverse pharmacological properties, including anti-inflammatory and anti-cancer activities, which are subjects of ongoing research. Overall, this compound exemplifies the significance of heterocycles in organic chemistry and their applications in pharmaceuticals.
Formula:C5H4N4
InChI:InChI=1S/C5H4N4/c1-2-7-5-4(6-1)3-8-9-5/h1-3H,(H,7,8,9)
InChI key:DDZGQYREBDXECY-UHFFFAOYSA-N
SMILES:C1=CN=C2C(=N1)C=NN2
Found 4 products.