CAS 272-68-4
:thieno[3,2-d]pyrimidine
Description:
Thieno[3,2-d]pyrimidine is a heterocyclic compound characterized by a fused ring system that incorporates both a thiophene and a pyrimidine moiety. This compound features a five-membered thiophene ring fused to a six-membered pyrimidine ring, resulting in a bicyclic structure. It is typically a pale yellow to light brown solid at room temperature and is known for its aromatic properties, which contribute to its stability and reactivity. Thieno[3,2-d]pyrimidine derivatives are of significant interest in medicinal chemistry due to their potential biological activities, including antiviral, anticancer, and anti-inflammatory properties. The compound is soluble in organic solvents, and its reactivity can be influenced by substituents on the rings, allowing for the synthesis of various derivatives with tailored properties. Additionally, thieno[3,2-d]pyrimidine can participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis.
Formula:C6H4N2S
InChI:InChI=1/C6H4N2S/c1-2-9-6-3-7-4-8-5(1)6/h1-4H
SMILES:c1csc2cncnc12
Synonyms:- Thienopyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Thieno[3,2-d]pyrimidine
CAS:7-Thieno[3,2-d]pyrimidines are potent antitumor agents that inhibit the activity of protein kinases. The 7-thieno[3,2-d]pyrimidine derivatives (e.g., AZD1775) were developed as inhibitors of DPP-IV enzyme and have shown promising results in clinical trials for treatment of type 2 diabetes. They are also being investigated for the treatment of autoimmune diseases, such as rheumatoid arthritis and multiple sclerosis. 7-Thieno[3,2-d]pyrimidines bind to the ATP binding site of enzymes in a competitive manner and inhibit the function of these enzymes by preventing ATP from binding to the enzyme's active site. These compounds have been shown to have antimicrobial properties against Leishmania species and myeloma cell lines. The 7-thieno[3,2-d]pyrimidines target receptor activity at GPCFormula:C6H4N2SPurity:Min. 95%Molecular weight:136.17 g/mol



